C12H22O8 — CID 173356154
2,2-dimethylpropyl (3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxane-3-carboxylate (PubChem CID 173356154) has the molecular formula C12H22O8 and a molecular weight of 294.30 g/mol. Its IUPAC name is 2,2-dimethylpropyl (3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxane-3-carboxylate.
| Compound Name | 2,2-dimethylpropyl (3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxane-3-carboxylate |
|---|---|
| PubChem CID | 173356154 |
| Molecular Formula | C12H22O8 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 2,2-dimethylpropyl (3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxane-3-carboxylate |
| SMILES | CC(C)(C)COC(=O)[C@]1(O)C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H22O8/c1-11(2,3)5-19-9(16)12(18)8(15)7(14)6(4-13)20-10(12)17/h6-8,10,13-15,17-18H,4-5H2,1-3H3/t6-,7-,8+,10?,12+/m1/s1 |
| InChIKey | LCMBXJJYPQXRPA-RNLCUJTHSA-N |
| XLogP | -2.26 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |