C8H17NO6 — CID 91278110
(3R,4S,5S,6R)-3-(2-aminoethyl)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 91278110) has the molecular formula C8H17NO6 and a molecular weight of 223.22 g/mol. Its IUPAC name is (3R,4S,5S,6R)-3-(2-aminoethyl)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (3R,4S,5S,6R)-3-(2-aminoethyl)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 91278110 |
| Molecular Formula | C8H17NO6 |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | (3R,4S,5S,6R)-3-(2-aminoethyl)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | NCC[C@]1(O)C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H17NO6/c9-2-1-8(14)6(12)5(11)4(3-10)15-7(8)13/h4-7,10-14H,1-3,9H2/t4-,5-,6+,7?,8-/m1/s1 |
| InChIKey | ZTBFXVJKJPEFAY-JTFAZQEDSA-N |
| XLogP | -3.50 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |