C6H15NO5Si — CID 154185512
(3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)-2-silyloxane-2,4,5-triol (PubChem CID 154185512) has the molecular formula C6H15NO5Si and a molecular weight of 209.27 g/mol. Its IUPAC name is (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)-2-silyloxane-2,4,5-triol.
| Compound Name | (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)-2-silyloxane-2,4,5-triol |
|---|---|
| PubChem CID | 154185512 |
| Molecular Formula | C6H15NO5Si |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)-2-silyloxane-2,4,5-triol |
| SMILES | N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)OC1(O)[SiH3] |
| InChI | InChI=1S/C6H15NO5Si/c7-5-4(10)3(9)2(1-8)12-6(5,11)13/h2-5,8-11H,1,7H2,13H3/t2-,3-,4+,5-,6?/m1/s1 |
| InChIKey | VWNVTRZOYQXENZ-GASJEMHNSA-N |
| XLogP | -4.56 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | -4.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|