C10H16O8 — CID 90778889
3-[(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]but-2-enoic acid (PubChem CID 90778889) has the molecular formula C10H16O8 and a molecular weight of 264.23 g/mol. Its IUPAC name is 3-[(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]but-2-enoic acid.
| Compound Name | 3-[(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 90778889 |
| Molecular Formula | C10H16O8 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 3-[(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]but-2-enoic acid |
| SMILES | CC(=CC(=O)O)C1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H16O8/c1-4(2-6(12)13)10(17)9(16)8(15)7(14)5(3-11)18-10/h2,5,7-9,11,14-17H,3H2,1H3,(H,12,13)/t5-,7-,8+,9-,10?/m1/s1 |
| InChIKey | ZHGCTNVIDHUVJP-QNRYFBKSSA-N |
| XLogP | -2.82 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|