About 1-methylcyclopropane-1,2,3-triamine
1-methylcyclopropane-1,2,3-triamine (PubChem CID 163904501) has the molecular formula C4H11N3
and a molecular weight of 101.15 g/mol. Its IUPAC name is 1-methylcyclopropane-1,2,3-triamine.
Molecular Properties
| Compound Name | 1-methylcyclopropane-1,2,3-triamine |
| PubChem CID | 163904501 |
| Molecular Formula | C4H11N3 |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.10 |
| IUPAC Name | 1-methylcyclopropane-1,2,3-triamine |
| SMILES | CC1(N)C(N)C1N |
| InChI | InChI=1S/C4H11N3/c1-4(7)2(5)3(4)6/h2-3H,5-7H2,1H3 |
| InChIKey | QMTMUJJFOIMONA-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methylcyclopropane-1,2,3-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylcyclopropane-1,2,3-triamine?
The IUPAC name of 1-methylcyclopropane-1,2,3-triamine (CID 163904501) is 1-methylcyclopropane-1,2,3-triamine.
What is the SMILES notation for 1-methylcyclopropane-1,2,3-triamine?
The canonical SMILES for 1-methylcyclopropane-1,2,3-triamine is CC1(N)C(N)C1N.
What is the InChIKey of 1-methylcyclopropane-1,2,3-triamine?
The InChIKey is QMTMUJJFOIMONA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N3/c1-4(7)2(5)3(4)6/h2-3H,5-7H2,1H3.
What are the key properties of 1-methylcyclopropane-1,2,3-triamine?
1-methylcyclopropane-1,2,3-triamine has a molecular weight of 101.15 g/mol, XLogP of -1.63, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylcyclopropane-1,2,3-triamine is sourced from PubChem (CID 163904501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).