C7H16N2 — CID 124747898
(1R,3R,4R)-1,4-dimethylcyclopentane-1,3-diamine (PubChem CID 124747898) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is (1R,3R,4R)-1,4-dimethylcyclopentane-1,3-diamine.
| Compound Name | (1R,3R,4R)-1,4-dimethylcyclopentane-1,3-diamine |
|---|---|
| PubChem CID | 124747898 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | (1R,3R,4R)-1,4-dimethylcyclopentane-1,3-diamine |
| SMILES | C[C@@H]1C[C@@](C)(N)C[C@H]1N |
| InChI | InChI=1S/C7H16N2/c1-5-3-7(2,9)4-6(5)8/h5-6H,3-4,8-9H2,1-2H3/t5-,6-,7-/m1/s1 |
| InChIKey | VCULFWOAEZSESU-FSDSQADBSA-N |
| XLogP | 0.46 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |