C12H25N — CID 123318765
3-tert-butyl-2,2,3,4-tetramethylcyclobutan-1-amine (PubChem CID 123318765) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is 3-tert-butyl-2,2,3,4-tetramethylcyclobutan-1-amine.
| Compound Name | 3-tert-butyl-2,2,3,4-tetramethylcyclobutan-1-amine |
|---|---|
| PubChem CID | 123318765 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | 3-tert-butyl-2,2,3,4-tetramethylcyclobutan-1-amine |
| SMILES | CC1C(N)C(C)(C)C1(C)C(C)(C)C |
| InChI | InChI=1S/C12H25N/c1-8-9(13)11(5,6)12(8,7)10(2,3)4/h8-9H,13H2,1-7H3 |
| InChIKey | NCPBZQZWKXJJAS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |