C8H19N3O — CID 163663382
2,3,4-triamino-1,2,3,4-tetramethylcyclobutan-1-ol (PubChem CID 163663382) has the molecular formula C8H19N3O and a molecular weight of 173.26 g/mol. Its IUPAC name is 2,3,4-triamino-1,2,3,4-tetramethylcyclobutan-1-ol.
| Compound Name | 2,3,4-triamino-1,2,3,4-tetramethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 163663382 |
| Molecular Formula | C8H19N3O |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.15 |
| IUPAC Name | 2,3,4-triamino-1,2,3,4-tetramethylcyclobutan-1-ol |
| SMILES | CC1(N)C(C)(N)C(C)(O)C1(C)N |
| InChI | InChI=1S/C8H19N3O/c1-5(9)6(2,10)8(4,12)7(5,3)11/h12H,9-11H2,1-4H3 |
| InChIKey | IWHHQHBHRNYUQM-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |