C7H14FNO5 — CID 162250851
(1R,2S,3S,4S,5S,6R)-6-amino-6-fluoro-2-methylcyclohexane-1,2,3,4,5-pentol (PubChem CID 162250851) has the molecular formula C7H14FNO5 and a molecular weight of 211.19 g/mol. Its IUPAC name is (1R,2S,3S,4S,5S,6R)-6-amino-6-fluoro-2-methylcyclohexane-1,2,3,4,5-pentol.
| Compound Name | (1R,2S,3S,4S,5S,6R)-6-amino-6-fluoro-2-methylcyclohexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 162250851 |
| Molecular Formula | C7H14FNO5 |
| Molecular Weight | 211.19 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | (1R,2S,3S,4S,5S,6R)-6-amino-6-fluoro-2-methylcyclohexane-1,2,3,4,5-pentol |
| SMILES | C[C@@]1(O)[C@@H](O)[C@](N)(F)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H14FNO5/c1-6(14)3(11)2(10)4(12)7(8,9)5(6)13/h2-5,10-14H,9H2,1H3/t2-,3-,4-,5+,6-,7-/m0/s1 |
| InChIKey | ITKNMCIIQVUVEH-GESKJZQWSA-N |
| XLogP | -3.18 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.19 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|