C6H11FO6 — CID 67417215
(2S,3S,5S,6S)-1-fluorocyclohexane-1,2,3,4,5,6-hexol (PubChem CID 67417215) has the molecular formula C6H11FO6 and a molecular weight of 198.15 g/mol. Its IUPAC name is (2S,3S,5S,6S)-1-fluorocyclohexane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3S,5S,6S)-1-fluorocyclohexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 67417215 |
| Molecular Formula | C6H11FO6 |
| Molecular Weight | 198.15 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | (2S,3S,5S,6S)-1-fluorocyclohexane-1,2,3,4,5,6-hexol |
| SMILES | OC1[C@H](O)[C@H](O)C(O)(F)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H11FO6/c7-6(13)4(11)2(9)1(8)3(10)5(6)12/h1-5,8-13H/t1?,2-,3-,4-,5-,6?/m0/s1 |
| InChIKey | HERODZOQBAKYQM-JBFQYEFVSA-N |
| XLogP | -3.54 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.15 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |