C6H10F2O4 — CID 130891885
(1S,2S,3S,4R)-5,5-difluorocyclohexane-1,2,3,4-tetrol (PubChem CID 130891885) has the molecular formula C6H10F2O4 and a molecular weight of 184.14 g/mol. Its IUPAC name is (1S,2S,3S,4R)-5,5-difluorocyclohexane-1,2,3,4-tetrol.
| Compound Name | (1S,2S,3S,4R)-5,5-difluorocyclohexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 130891885 |
| Molecular Formula | C6H10F2O4 |
| Molecular Weight | 184.14 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | (1S,2S,3S,4R)-5,5-difluorocyclohexane-1,2,3,4-tetrol |
| SMILES | O[C@@H]1[C@H](O)[C@@H](O)C(F)(F)C[C@@H]1O |
| InChI | InChI=1S/C6H10F2O4/c7-6(8)1-2(9)3(10)4(11)5(6)12/h2-5,9-12H,1H2/t2-,3-,4-,5+/m0/s1 |
| InChIKey | CALKILZMYWDLNQ-NEEWWZBLSA-N |
| XLogP | -1.53 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.14 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |