C5H8F2O4 — CID 10855910
(2R,4R,5R)-3,3-difluorooxane-2,4,5-triol (PubChem CID 10855910) has the molecular formula C5H8F2O4 and a molecular weight of 170.11 g/mol. Its IUPAC name is (2R,4R,5R)-3,3-difluorooxane-2,4,5-triol.
| Compound Name | (2R,4R,5R)-3,3-difluorooxane-2,4,5-triol |
|---|---|
| PubChem CID | 10855910 |
| Molecular Formula | C5H8F2O4 |
| Molecular Weight | 170.11 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | (2R,4R,5R)-3,3-difluorooxane-2,4,5-triol |
| SMILES | O[C@@H]1CO[C@@H](O)C(F)(F)[C@@H]1O |
| InChI | InChI=1S/C5H8F2O4/c6-5(7)3(9)2(8)1-11-4(5)10/h2-4,8-10H,1H2/t2-,3-,4-/m1/s1 |
| InChIKey | BPUVAOQHZHKCNH-BXXZVTAOSA-N |
| XLogP | -1.31 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.11 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |