C10H10F2 — CID 52630352
1-[(1S)-2,2-difluorocyclopropyl]-4-methylbenzene (PubChem CID 52630352) has the molecular formula C10H10F2 and a molecular weight of 168.19 g/mol. Its IUPAC name is 1-[(1S)-2,2-difluorocyclopropyl]-4-methylbenzene.
| Compound Name | 1-[(1S)-2,2-difluorocyclopropyl]-4-methylbenzene |
|---|---|
| PubChem CID | 52630352 |
| Molecular Formula | C10H10F2 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 1-[(1S)-2,2-difluorocyclopropyl]-4-methylbenzene |
| SMILES | Cc1ccc([C@@H]2CC2(F)F)cc1 |
| InChI | InChI=1S/C10H10F2/c1-7-2-4-8(5-3-7)9-6-10(9,11)12/h2-5,9H,6H2,1H3/t9-/m0/s1 |
| InChIKey | VCYGRUJYOJHIQL-VIFPVBQESA-N |
| XLogP | 3.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |