C11H10F2O — CID 121222554
(2,2-difluorocyclopropyl)-(4-methylphenyl)methanone (PubChem CID 121222554) has the molecular formula C11H10F2O and a molecular weight of 196.20 g/mol. Its IUPAC name is (2,2-difluorocyclopropyl)-(4-methylphenyl)methanone.
| Compound Name | (2,2-difluorocyclopropyl)-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 121222554 |
| Molecular Formula | C11H10F2O |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (2,2-difluorocyclopropyl)-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)C2CC2(F)F)cc1 |
| InChI | InChI=1S/C11H10F2O/c1-7-2-4-8(5-3-7)10(14)9-6-11(9,12)13/h2-5,9H,6H2,1H3 |
| InChIKey | CFGFYLNVZGVYRQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |