C13H15F2NO2 — CID 166284406
N-[(1R,2S)-3,3-difluoro-2-hydroxycyclopentyl]-4-methylbenzamide (PubChem CID 166284406) has the molecular formula C13H15F2NO2 and a molecular weight of 255.26 g/mol. Its IUPAC name is N-[(1R,2S)-3,3-difluoro-2-hydroxycyclopentyl]-4-methylbenzamide.
| Compound Name | N-[(1R,2S)-3,3-difluoro-2-hydroxycyclopentyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 166284406 |
| Molecular Formula | C13H15F2NO2 |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | N-[(1R,2S)-3,3-difluoro-2-hydroxycyclopentyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N[C@@H]2CCC(F)(F)[C@H]2O)cc1 |
| InChI | InChI=1S/C13H15F2NO2/c1-8-2-4-9(5-3-8)12(18)16-10-6-7-13(14,15)11(10)17/h2-5,10-11,17H,6-7H2,1H3,(H,16,18)/t10-,11+/m1/s1 |
| InChIKey | YESLDCCXDSICSU-MNOVXSKESA-N |
| XLogP | 1.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |