C18H20FNO — CID 145473701
N-cyclopropyl-4-methylbenzamide;1-fluoro-2-methylbenzene (PubChem CID 145473701) has the molecular formula C18H20FNO and a molecular weight of 285.36 g/mol. Its IUPAC name is N-cyclopropyl-4-methylbenzamide;1-fluoro-2-methylbenzene.
| Compound Name | N-cyclopropyl-4-methylbenzamide;1-fluoro-2-methylbenzene |
|---|---|
| PubChem CID | 145473701 |
| Molecular Formula | C18H20FNO |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-cyclopropyl-4-methylbenzamide;1-fluoro-2-methylbenzene |
| SMILES | Cc1ccc(C(=O)NC2CC2)cc1.Cc1ccccc1F |
| InChI | InChI=1S/C11H13NO.C7H7F/c1-8-2-4-9(5-3-8)11(13)12-10-6-7-10;1-6-4-2-3-5-7(6)8/h2-5,10H,6-7H2,1H3,(H,12,13);2-5H,1H3 |
| InChIKey | IYNCJLHQUJBCHU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |