C7H12F2O5 — CID 102472709
(1S,2S,3R,4R,6R)-5,5-difluoro-6-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol (PubChem CID 102472709) has the molecular formula C7H12F2O5 and a molecular weight of 214.16 g/mol. Its IUPAC name is (1S,2S,3R,4R,6R)-5,5-difluoro-6-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol.
| Compound Name | (1S,2S,3R,4R,6R)-5,5-difluoro-6-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 102472709 |
| Molecular Formula | C7H12F2O5 |
| Molecular Weight | 214.16 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | (1S,2S,3R,4R,6R)-5,5-difluoro-6-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol |
| SMILES | OC[C@@H]1[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)C1(F)F |
| InChI | InChI=1S/C7H12F2O5/c8-7(9)2(1-10)3(11)4(12)5(13)6(7)14/h2-6,10-14H,1H2/t2-,3+,4+,5-,6-/m1/s1 |
| InChIKey | DCEKIUUYRVWFAO-FPRJBGLDSA-N |
| XLogP | -2.31 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.16 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |