C10H18F2O4 — CID 20758643
2-tert-butyl-5,5-difluoro-6-(hydroxymethyl)oxane-3,4-diol (PubChem CID 20758643) has the molecular formula C10H18F2O4 and a molecular weight of 240.25 g/mol. Its IUPAC name is 2-tert-butyl-5,5-difluoro-6-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | 2-tert-butyl-5,5-difluoro-6-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 20758643 |
| Molecular Formula | C10H18F2O4 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2-tert-butyl-5,5-difluoro-6-(hydroxymethyl)oxane-3,4-diol |
| SMILES | CC(C)(C)C1OC(CO)C(F)(F)C(O)C1O |
| InChI | InChI=1S/C10H18F2O4/c1-9(2,3)8-6(14)7(15)10(11,12)5(4-13)16-8/h5-8,13-15H,4H2,1-3H3 |
| InChIKey | LJDSLUGMCSGFTP-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |