C7H12F2O4 — CID 54763879
(2R,4R,6S)-3,3-difluoro-2-(hydroxymethyl)-6-methoxyoxan-4-ol (PubChem CID 54763879) has the molecular formula C7H12F2O4 and a molecular weight of 198.16 g/mol. Its IUPAC name is (2R,4R,6S)-3,3-difluoro-2-(hydroxymethyl)-6-methoxyoxan-4-ol.
| Compound Name | (2R,4R,6S)-3,3-difluoro-2-(hydroxymethyl)-6-methoxyoxan-4-ol |
|---|---|
| PubChem CID | 54763879 |
| Molecular Formula | C7H12F2O4 |
| Molecular Weight | 198.16 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | (2R,4R,6S)-3,3-difluoro-2-(hydroxymethyl)-6-methoxyoxan-4-ol |
| SMILES | CO[C@@H]1C[C@@H](O)C(F)(F)[C@@H](CO)O1 |
| InChI | InChI=1S/C7H12F2O4/c1-12-6-2-4(11)7(8,9)5(3-10)13-6/h4-6,10-11H,2-3H2,1H3/t4-,5-,6+/m1/s1 |
| InChIKey | CJHSBYOQWWYIFV-PBXRRBTRSA-N |
| XLogP | -0.26 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.16 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |