C7H15NO4 — CID 101213890
(2R,3S,4R,6R)-4-amino-2-(hydroxymethyl)-6-methoxyoxan-3-ol (PubChem CID 101213890) has the molecular formula C7H15NO4 and a molecular weight of 177.20 g/mol. Its IUPAC name is (2R,3S,4R,6R)-4-amino-2-(hydroxymethyl)-6-methoxyoxan-3-ol.
| Compound Name | (2R,3S,4R,6R)-4-amino-2-(hydroxymethyl)-6-methoxyoxan-3-ol |
|---|---|
| PubChem CID | 101213890 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | (2R,3S,4R,6R)-4-amino-2-(hydroxymethyl)-6-methoxyoxan-3-ol |
| SMILES | CO[C@H]1C[C@@H](N)[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C7H15NO4/c1-11-6-2-4(8)7(10)5(3-9)12-6/h4-7,9-10H,2-3,8H2,1H3/t4-,5-,6-,7+/m1/s1 |
| InChIKey | FEOSBRNHHYNQSH-GBNDHIKLSA-N |
| XLogP | -1.57 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |