C6H14N2O2 — CID 131848824
(2R,3S,5R)-2-(aminomethyl)-5-methoxyoxolan-3-amine (PubChem CID 131848824) has the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. Its IUPAC name is (2R,3S,5R)-2-(aminomethyl)-5-methoxyoxolan-3-amine.
| Compound Name | (2R,3S,5R)-2-(aminomethyl)-5-methoxyoxolan-3-amine |
|---|---|
| PubChem CID | 131848824 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | (2R,3S,5R)-2-(aminomethyl)-5-methoxyoxolan-3-amine |
| SMILES | CO[C@H]1C[C@H](N)[C@@H](CN)O1 |
| InChI | InChI=1S/C6H14N2O2/c1-9-6-2-4(8)5(3-7)10-6/h4-6H,2-3,7-8H2,1H3/t4-,5+,6+/m0/s1 |
| InChIKey | WQMISXRQMWWXKU-KVQBGUIXSA-N |
| XLogP | -0.97 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |