C7H15NO3 — CID 70527934
(2S,3R,4S)-4-amino-6-methoxy-2-methyloxan-3-ol (PubChem CID 70527934) has the molecular formula C7H15NO3 and a molecular weight of 161.20 g/mol. Its IUPAC name is (2S,3R,4S)-4-amino-6-methoxy-2-methyloxan-3-ol.
| Compound Name | (2S,3R,4S)-4-amino-6-methoxy-2-methyloxan-3-ol |
|---|---|
| PubChem CID | 70527934 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | (2S,3R,4S)-4-amino-6-methoxy-2-methyloxan-3-ol |
| SMILES | COC1C[C@H](N)[C@@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C7H15NO3/c1-4-7(9)5(8)3-6(10-2)11-4/h4-7,9H,3,8H2,1-2H3/t4-,5-,6?,7-/m0/s1 |
| InChIKey | UIWJWFKPPXKEJV-KQXJUZEQSA-N |
| XLogP | -0.54 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |