C6H14ClNO3 — CID 91980014
(2S,5S)-4-amino-6-methyloxane-2,5-diol;hydrochloride (PubChem CID 91980014) has the molecular formula C6H14ClNO3 and a molecular weight of 183.63 g/mol. Its IUPAC name is (2S,5S)-4-amino-6-methyloxane-2,5-diol;hydrochloride.
| Compound Name | (2S,5S)-4-amino-6-methyloxane-2,5-diol;hydrochloride |
|---|---|
| PubChem CID | 91980014 |
| Molecular Formula | C6H14ClNO3 |
| Molecular Weight | 183.63 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | (2S,5S)-4-amino-6-methyloxane-2,5-diol;hydrochloride |
| SMILES | CC1O[C@H](O)CC(N)[C@@H]1O.Cl |
| InChI | InChI=1S/C6H13NO3.ClH/c1-3-6(9)4(7)2-5(8)10-3;/h3-6,8-9H,2,7H2,1H3;1H/t3?,4?,5-,6+;/m0./s1 |
| InChIKey | JLNTUORJIVKDRG-VSXNQDMQSA-N |
| XLogP | -0.78 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.63 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |