C8H15NO4 — CID 13387486
N-[(2S,3S,4S)-3,6-dihydroxy-2-methyloxan-4-yl]acetamide (PubChem CID 13387486) has the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. Its IUPAC name is N-[(2S,3S,4S)-3,6-dihydroxy-2-methyloxan-4-yl]acetamide.
| Compound Name | N-[(2S,3S,4S)-3,6-dihydroxy-2-methyloxan-4-yl]acetamide |
|---|---|
| PubChem CID | 13387486 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | N-[(2S,3S,4S)-3,6-dihydroxy-2-methyloxan-4-yl]acetamide |
| SMILES | CC(=O)N[C@H]1CC(O)O[C@@H](C)[C@H]1O |
| InChI | InChI=1S/C8H15NO4/c1-4-8(12)6(9-5(2)10)3-7(11)13-4/h4,6-8,11-12H,3H2,1-2H3,(H,9,10)/t4-,6-,7?,8+/m0/s1 |
| InChIKey | WDMSIBWBBAAFED-QXIKOAFUSA-N |
| XLogP | -1.02 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |