C10H14F3NO5 — CID 15143831
[(2S,3R,4R,6S)-6-hydroxy-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate (PubChem CID 15143831) has the molecular formula C10H14F3NO5 and a molecular weight of 285.22 g/mol. Its IUPAC name is [(2S,3R,4R,6S)-6-hydroxy-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate.
| Compound Name | [(2S,3R,4R,6S)-6-hydroxy-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 15143831 |
| Molecular Formula | C10H14F3NO5 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | [(2S,3R,4R,6S)-6-hydroxy-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](C)O[C@H](O)C[C@H]1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H14F3NO5/c1-4-8(19-5(2)15)6(3-7(16)18-4)14-9(17)10(11,12)13/h4,6-8,16H,3H2,1-2H3,(H,14,17)/t4-,6+,7-,8-/m0/s1 |
| InChIKey | DPLRHOYKSIFHCE-UCVXFZOQSA-N |
| XLogP | 0.09 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |