About N-(6-aminooxy-3-hydroxy-2-methyloxan-4-yl)-2,2,2-trifluoroacetamide
N-(6-aminooxy-3-hydroxy-2-methyloxan-4-yl)-2,2,2-trifluoroacetamide (PubChem CID 162576238) has the molecular formula C8H13F3N2O4
and a molecular weight of 258.20 g/mol. Its IUPAC name is N-(6-aminooxy-3-hydroxy-2-methyloxan-4-yl)-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-(6-aminooxy-3-hydroxy-2-methyloxan-4-yl)-2,2,2-trifluoroacetamide |
| PubChem CID | 162576238 |
| Molecular Formula | C8H13F3N2O4 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | N-(6-aminooxy-3-hydroxy-2-methyloxan-4-yl)-2,2,2-trifluoroacetamide |
| SMILES | CC1OC(ON)CC(NC(=O)C(F)(F)F)C1O |
| InChI | InChI=1S/C8H13F3N2O4/c1-3-6(14)4(2-5(16-3)17-12)13-7(15)8(9,10)11/h3-6,14H,2,12H2,1H3,(H,13,15) |
| InChIKey | PVHBDZXLRIPLOH-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(6-aminooxy-3-hydroxy-2-methyloxan-4-yl)-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-aminooxy-3-hydroxy-2-methyloxan-4-yl)-2,2,2-trifluoroacetamide?
The IUPAC name of N-(6-aminooxy-3-hydroxy-2-methyloxan-4-yl)-2,2,2-trifluoroacetamide (CID 162576238) is N-(6-aminooxy-3-hydroxy-2-methyloxan-4-yl)-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-(6-aminooxy-3-hydroxy-2-methyloxan-4-yl)-2,2,2-trifluoroacetamide?
The canonical SMILES for N-(6-aminooxy-3-hydroxy-2-methyloxan-4-yl)-2,2,2-trifluoroacetamide is CC1OC(ON)CC(NC(=O)C(F)(F)F)C1O.
What is the InChIKey of N-(6-aminooxy-3-hydroxy-2-methyloxan-4-yl)-2,2,2-trifluoroacetamide?
The InChIKey is PVHBDZXLRIPLOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3N2O4/c1-3-6(14)4(2-5(16-3)17-12)13-7(15)8(9,10)11/h3-6,14H,2,12H2,1H3,(H,13,15).
What are the key properties of N-(6-aminooxy-3-hydroxy-2-methyloxan-4-yl)-2,2,2-trifluoroacetamide?
N-(6-aminooxy-3-hydroxy-2-methyloxan-4-yl)-2,2,2-trifluoroacetamide has a molecular weight of 258.20 g/mol, XLogP of -0.58, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-aminooxy-3-hydroxy-2-methyloxan-4-yl)-2,2,2-trifluoroacetamide is sourced from PubChem (CID 162576238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).