C8H13F3N2O4 — CID 162576238
N-(6-aminooxy-3-hydroxy-2-methyloxan-4-yl)-2,2,2-trifluoroacetamide (PubChem CID 162576238) has the molecular formula C8H13F3N2O4 and a molecular weight of 258.20 g/mol. Its IUPAC name is N-(6-aminooxy-3-hydroxy-2-methyloxan-4-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(6-aminooxy-3-hydroxy-2-methyloxan-4-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 162576238 |
| Molecular Formula | C8H13F3N2O4 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | N-(6-aminooxy-3-hydroxy-2-methyloxan-4-yl)-2,2,2-trifluoroacetamide |
| SMILES | CC1OC(ON)CC(NC(=O)C(F)(F)F)C1O |
| InChI | InChI=1S/C8H13F3N2O4/c1-3-6(14)4(2-5(16-3)17-12)13-7(15)8(9,10)11/h3-6,14H,2,12H2,1H3,(H,13,15) |
| InChIKey | PVHBDZXLRIPLOH-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|