C16H28F3NO5Si — CID 102013077
[(2S,3S,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate (PubChem CID 102013077) has the molecular formula C16H28F3NO5Si and a molecular weight of 399.48 g/mol. Its IUPAC name is [(2S,3S,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate.
| Compound Name | [(2S,3S,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 102013077 |
| Molecular Formula | C16H28F3NO5Si |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | [(2S,3S,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](C)O[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C16H28F3NO5Si/c1-9-13(24-10(2)21)11(20-14(22)16(17,18)19)8-12(23-9)25-26(6,7)15(3,4)5/h9,11-13H,8H2,1-7H3,(H,20,22)/t9-,11+,12+,13+/m0/s1 |
| InChIKey | YDADMHRWGWVZDX-WKSBVSIWSA-N |
| XLogP | 3.12 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|