C12H16F3NO5 — CID 10448151
[(2S,3S,4S,6R)-2-methyl-6-(2-oxoethyl)-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate (PubChem CID 10448151) has the molecular formula C12H16F3NO5 and a molecular weight of 311.26 g/mol. Its IUPAC name is [(2S,3S,4S,6R)-2-methyl-6-(2-oxoethyl)-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate.
| Compound Name | [(2S,3S,4S,6R)-2-methyl-6-(2-oxoethyl)-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 10448151 |
| Molecular Formula | C12H16F3NO5 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | [(2S,3S,4S,6R)-2-methyl-6-(2-oxoethyl)-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](NC(=O)C(F)(F)F)C[C@H](CC=O)O[C@H]1C |
| InChI | InChI=1S/C12H16F3NO5/c1-6-10(21-7(2)18)9(5-8(20-6)3-4-17)16-11(19)12(13,14)15/h4,6,8-10H,3,5H2,1-2H3,(H,16,19)/t6-,8-,9-,10+/m0/s1 |
| InChIKey | HNNHINLIBLECDX-MIBSWOBISA-N |
| XLogP | 0.73 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|