C17H17F3N2O7 — CID 88671305
[(2R,3R,4S,6R)-2-methyl-6-(2-oxoethyl)-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] 4-nitrobenzoate (PubChem CID 88671305) has the molecular formula C17H17F3N2O7 and a molecular weight of 418.32 g/mol. Its IUPAC name is [(2R,3R,4S,6R)-2-methyl-6-(2-oxoethyl)-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] 4-nitrobenzoate.
| Compound Name | [(2R,3R,4S,6R)-2-methyl-6-(2-oxoethyl)-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 88671305 |
| Molecular Formula | C17H17F3N2O7 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | [(2R,3R,4S,6R)-2-methyl-6-(2-oxoethyl)-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] 4-nitrobenzoate |
| SMILES | C[C@H]1O[C@@H](CC=O)C[C@H](NC(=O)C(F)(F)F)[C@H]1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H17F3N2O7/c1-9-14(29-15(24)10-2-4-11(5-3-10)22(26)27)13(8-12(28-9)6-7-23)21-16(25)17(18,19)20/h2-5,7,9,12-14H,6,8H2,1H3,(H,21,25)/t9-,12+,13+,14+/m1/s1 |
| InChIKey | XBDGVTRHBGUOBJ-HYNSBDGHSA-N |
| XLogP | 1.93 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|