C34H28F3NO8 — CID 88671130
[(2S,3S,4S,6S)-6-[(5,12-dihydroxy-6,11-dioxo-1,4-dihydrotetracen-2-yl)methyl]-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] benzoate (PubChem CID 88671130) has the molecular formula C34H28F3NO8 and a molecular weight of 635.59 g/mol. Its IUPAC name is [(2S,3S,4S,6S)-6-[(5,12-dihydroxy-6,11-dioxo-1,4-dihydrotetracen-2-yl)methyl]-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] benzoate.
| Compound Name | [(2S,3S,4S,6S)-6-[(5,12-dihydroxy-6,11-dioxo-1,4-dihydrotetracen-2-yl)methyl]-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 88671130 |
| Molecular Formula | C34H28F3NO8 |
| Molecular Weight | 635.59 g/mol |
| Exact Mass | 635.18 |
| IUPAC Name | [(2S,3S,4S,6S)-6-[(5,12-dihydroxy-6,11-dioxo-1,4-dihydrotetracen-2-yl)methyl]-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] benzoate |
| SMILES | C[C@@H]1O[C@@H](CC2=CCc3c(O)c4c(c(O)c3C2)C(=O)c2ccccc2C4=O)C[C@H](NC(=O)C(F)(F)F)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H28F3NO8/c1-16-31(46-32(43)18-7-3-2-4-8-18)24(38-33(44)34(35,36)37)15-19(45-16)13-17-11-12-22-23(14-17)30(42)26-25(29(22)41)27(39)20-9-5-6-10-21(20)28(26)40/h2-11,16,19,24,31,41-42H,12-15H2,1H3,(H,38,44)/t16-,19-,24-,31+/m0/s1 |
| InChIKey | FBYCABYLNDSDRK-OTRISYOFSA-N |
| XLogP | 4.74 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.59 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|