C23H20F3NO5 — CID 88673720
N-[(2S,3S,4S,6S)-6-[(9,10-dioxoanthracen-1-yl)methyl]-3-hydroxy-2-methyloxan-4-yl]-2,2,2-trifluoroacetamide (PubChem CID 88673720) has the molecular formula C23H20F3NO5 and a molecular weight of 447.41 g/mol. Its IUPAC name is N-[(2S,3S,4S,6S)-6-[(9,10-dioxoanthracen-1-yl)methyl]-3-hydroxy-2-methyloxan-4-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2S,3S,4S,6S)-6-[(9,10-dioxoanthracen-1-yl)methyl]-3-hydroxy-2-methyloxan-4-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 88673720 |
| Molecular Formula | C23H20F3NO5 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N-[(2S,3S,4S,6S)-6-[(9,10-dioxoanthracen-1-yl)methyl]-3-hydroxy-2-methyloxan-4-yl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@@H]1O[C@@H](Cc2cccc3c2C(=O)c2ccccc2C3=O)C[C@H](NC(=O)C(F)(F)F)[C@@H]1O |
| InChI | InChI=1S/C23H20F3NO5/c1-11-19(28)17(27-22(31)23(24,25)26)10-13(32-11)9-12-5-4-8-16-18(12)21(30)15-7-3-2-6-14(15)20(16)29/h2-8,11,13,17,19,28H,9-10H2,1H3,(H,27,31)/t11-,13-,17-,19+/m0/s1 |
| InChIKey | FMDPLXNLFBMLKF-GATJQBSYSA-N |
| XLogP | 2.59 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|