C15H16Cl2N2O6 — CID 70477955
[(2R,3R,4S,6R)-6-chloro-4-[(2-chloroacetyl)amino]-2-methyloxan-3-yl] 4-nitrobenzoate (PubChem CID 70477955) has the molecular formula C15H16Cl2N2O6 and a molecular weight of 391.21 g/mol. Its IUPAC name is [(2R,3R,4S,6R)-6-chloro-4-[(2-chloroacetyl)amino]-2-methyloxan-3-yl] 4-nitrobenzoate.
| Compound Name | [(2R,3R,4S,6R)-6-chloro-4-[(2-chloroacetyl)amino]-2-methyloxan-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 70477955 |
| Molecular Formula | C15H16Cl2N2O6 |
| Molecular Weight | 391.21 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | [(2R,3R,4S,6R)-6-chloro-4-[(2-chloroacetyl)amino]-2-methyloxan-3-yl] 4-nitrobenzoate |
| SMILES | C[C@H]1O[C@H](Cl)C[C@H](NC(=O)CCl)[C@H]1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H16Cl2N2O6/c1-8-14(11(6-12(17)24-8)18-13(20)7-16)25-15(21)9-2-4-10(5-3-9)19(22)23/h2-5,8,11-12,14H,6-7H2,1H3,(H,18,20)/t8-,11+,12+,14+/m1/s1 |
| InChIKey | KGYPSTQUKVEQOQ-JRQIVUDYSA-N |
| XLogP | 2.22 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.21 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|