C14H17ClN2O7S — CID 101133297
[(2S,3S,4S)-6-chloro-2-methyl-4-[(4-nitrophenyl)sulfonylamino]oxan-3-yl] acetate (PubChem CID 101133297) has the molecular formula C14H17ClN2O7S and a molecular weight of 392.82 g/mol. Its IUPAC name is [(2S,3S,4S)-6-chloro-2-methyl-4-[(4-nitrophenyl)sulfonylamino]oxan-3-yl] acetate.
| Compound Name | [(2S,3S,4S)-6-chloro-2-methyl-4-[(4-nitrophenyl)sulfonylamino]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 101133297 |
| Molecular Formula | C14H17ClN2O7S |
| Molecular Weight | 392.82 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | [(2S,3S,4S)-6-chloro-2-methyl-4-[(4-nitrophenyl)sulfonylamino]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC(Cl)O[C@H]1C |
| InChI | InChI=1S/C14H17ClN2O7S/c1-8-14(24-9(2)18)12(7-13(15)23-8)16-25(21,22)11-5-3-10(4-6-11)17(19)20/h3-6,8,12-14,16H,7H2,1-2H3/t8-,12-,13?,14+/m0/s1 |
| InChIKey | JYUSBXFXVCNGMS-VKLIXBJESA-N |
| XLogP | 1.55 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.82 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|