C13H16N2O4S — CID 7462489
N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4-nitrobenzenesulfonamide (PubChem CID 7462489) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 7462489 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N[C@H]2C[C@H]3CC[C@H]2C3)cc1 |
| InChI | InChI=1S/C13H16N2O4S/c16-15(17)11-3-5-12(6-4-11)20(18,19)14-13-8-9-1-2-10(13)7-9/h3-6,9-10,13-14H,1-2,7-8H2/t9-,10-,13-/m0/s1 |
| InChIKey | YUFKLKBIXHGELG-KWBADKCTSA-N |
| XLogP | 2.06 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|