C15H21NO3S — CID 4297774
N-(2-bicyclo[2.2.1]heptanyl)-4-ethoxybenzenesulfonamide (PubChem CID 4297774) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanyl)-4-ethoxybenzenesulfonamide.
| Compound Name | N-(2-bicyclo[2.2.1]heptanyl)-4-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 4297774 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanyl)-4-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NC2CC3CCC2C3)cc1 |
| InChI | InChI=1S/C15H21NO3S/c1-2-19-13-5-7-14(8-6-13)20(17,18)16-15-10-11-3-4-12(15)9-11/h5-8,11-12,15-16H,2-4,9-10H2,1H3 |
| InChIKey | TYAPBXYYMFMLOI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |