C11H15N3O4S — CID 165494158
N-[(2S,3R)-2-methylpyrrolidin-3-yl]-4-nitrobenzenesulfonamide (PubChem CID 165494158) has the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. Its IUPAC name is N-[(2S,3R)-2-methylpyrrolidin-3-yl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[(2S,3R)-2-methylpyrrolidin-3-yl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 165494158 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N-[(2S,3R)-2-methylpyrrolidin-3-yl]-4-nitrobenzenesulfonamide |
| SMILES | C[C@@H]1NCC[C@H]1NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H15N3O4S/c1-8-11(6-7-12-8)13-19(17,18)10-4-2-9(3-5-10)14(15)16/h2-5,8,11-13H,6-7H2,1H3/t8-,11+/m0/s1 |
| InChIKey | AHDAONKRSYXYEV-GZMMTYOYSA-N |
| XLogP | 0.62 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|