C13H18N2O6S — CID 124856433
N-[(1S,2R,3R)-3-ethoxy-2-methoxycyclobutyl]-4-nitrobenzenesulfonamide (PubChem CID 124856433) has the molecular formula C13H18N2O6S and a molecular weight of 330.36 g/mol. Its IUPAC name is N-[(1S,2R,3R)-3-ethoxy-2-methoxycyclobutyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[(1S,2R,3R)-3-ethoxy-2-methoxycyclobutyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 124856433 |
| Molecular Formula | C13H18N2O6S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | N-[(1S,2R,3R)-3-ethoxy-2-methoxycyclobutyl]-4-nitrobenzenesulfonamide |
| SMILES | CCO[C@@H]1C[C@H](NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)[C@H]1OC |
| InChI | InChI=1S/C13H18N2O6S/c1-3-21-12-8-11(13(12)20-2)14-22(18,19)10-6-4-9(5-7-10)15(16)17/h4-7,11-14H,3,8H2,1-2H3/t11-,12+,13+/m0/s1 |
| InChIKey | KLPUQGDNUNJSQS-YNEHKIRRSA-N |
| XLogP | 1.07 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|