C13H17FN2O6S — CID 124727155
N-[(1R,2R,3R)-3-ethoxy-2-methoxycyclobutyl]-3-fluoro-2-nitrobenzenesulfonamide (PubChem CID 124727155) has the molecular formula C13H17FN2O6S and a molecular weight of 348.35 g/mol. Its IUPAC name is N-[(1R,2R,3R)-3-ethoxy-2-methoxycyclobutyl]-3-fluoro-2-nitrobenzenesulfonamide.
| Compound Name | N-[(1R,2R,3R)-3-ethoxy-2-methoxycyclobutyl]-3-fluoro-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 124727155 |
| Molecular Formula | C13H17FN2O6S |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | N-[(1R,2R,3R)-3-ethoxy-2-methoxycyclobutyl]-3-fluoro-2-nitrobenzenesulfonamide |
| SMILES | CCO[C@@H]1C[C@@H](NS(=O)(=O)c2cccc(F)c2[N+](=O)[O-])[C@H]1OC |
| InChI | InChI=1S/C13H17FN2O6S/c1-3-22-10-7-9(13(10)21-2)15-23(19,20)11-6-4-5-8(14)12(11)16(17)18/h4-6,9-10,13,15H,3,7H2,1-2H3/t9-,10-,13-/m1/s1 |
| InChIKey | COZDGCSAMOYCOM-GIPNMCIBSA-N |
| XLogP | 1.20 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|