C28H28F3N3O13 — CID 10699652
[(2S,3R,4S)-6-hydroxy-2-methyl-3-[(2S,4S,5S,6S)-6-methyl-5-(4-nitrobenzoyl)oxy-4-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]oxyoxan-4-yl] 4-nitrobenzoate (PubChem CID 10699652) has the molecular formula C28H28F3N3O13 and a molecular weight of 671.53 g/mol. Its IUPAC name is [(2S,3R,4S)-6-hydroxy-2-methyl-3-[(2S,4S,5S,6S)-6-methyl-5-(4-nitrobenzoyl)oxy-4-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]oxyoxan-4-yl] 4-nitrobenzoate.
| Compound Name | [(2S,3R,4S)-6-hydroxy-2-methyl-3-[(2S,4S,5S,6S)-6-methyl-5-(4-nitrobenzoyl)oxy-4-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]oxyoxan-4-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 10699652 |
| Molecular Formula | C28H28F3N3O13 |
| Molecular Weight | 671.53 g/mol |
| Exact Mass | 671.16 |
| IUPAC Name | [(2S,3R,4S)-6-hydroxy-2-methyl-3-[(2S,4S,5S,6S)-6-methyl-5-(4-nitrobenzoyl)oxy-4-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]oxyoxan-4-yl] 4-nitrobenzoate |
| SMILES | C[C@@H]1OC(O)C[C@H](OC(=O)c2ccc([N+](=O)[O-])cc2)[C@@H]1O[C@H]1CC(NC(=O)C(F)(F)F)[C@H](OC(=O)c2ccc([N+](=O)[O-])cc2)[C@H](C)O1 |
| InChI | InChI=1S/C28H28F3N3O13/c1-13-23(47-26(37)16-5-9-18(10-6-16)34(41)42)19(32-27(38)28(29,30)31)11-22(44-13)46-24-14(2)43-21(35)12-20(24)45-25(36)15-3-7-17(8-4-15)33(39)40/h3-10,13-14,19-24,35H,11-12H2,1-2H3,(H,32,38)/t13-,14-,19?,20-,21?,22-,23+,24+/m0/s1 |
| InChIKey | INKNHNVYDRSUNH-UNUQKANBSA-N |
| XLogP | 2.95 |
| TPSA | 215.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|