C27H29F3N2O9 — CID 101459790
[(2R,3R,4S,6R)-2-heptyl-3-(4-nitrobenzoyl)oxy-6-(trifluoromethyl)oxan-4-yl] 4-nitrobenzoate (PubChem CID 101459790) has the molecular formula C27H29F3N2O9 and a molecular weight of 582.53 g/mol. Its IUPAC name is [(2R,3R,4S,6R)-2-heptyl-3-(4-nitrobenzoyl)oxy-6-(trifluoromethyl)oxan-4-yl] 4-nitrobenzoate.
| Compound Name | [(2R,3R,4S,6R)-2-heptyl-3-(4-nitrobenzoyl)oxy-6-(trifluoromethyl)oxan-4-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 101459790 |
| Molecular Formula | C27H29F3N2O9 |
| Molecular Weight | 582.53 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | [(2R,3R,4S,6R)-2-heptyl-3-(4-nitrobenzoyl)oxy-6-(trifluoromethyl)oxan-4-yl] 4-nitrobenzoate |
| SMILES | CCCCCCC[C@H]1O[C@@H](C(F)(F)F)C[C@H](OC(=O)c2ccc([N+](=O)[O-])cc2)[C@@H]1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H29F3N2O9/c1-2-3-4-5-6-7-21-24(41-26(34)18-10-14-20(15-11-18)32(37)38)22(16-23(39-21)27(28,29)30)40-25(33)17-8-12-19(13-9-17)31(35)36/h8-15,21-24H,2-7,16H2,1H3/t21-,22+,23-,24-/m1/s1 |
| InChIKey | VLMMKAHXNUGSGY-UEQSERJNSA-N |
| XLogP | 6.33 |
| TPSA | 148.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.53 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|