C22H23NO7 — CID 24741484
[(2S,3S,6R)-6-[(4-methoxyphenyl)methoxy]-2,4-dimethyl-3,6-dihydro-2H-pyran-3-yl] 4-nitrobenzoate (PubChem CID 24741484) has the molecular formula C22H23NO7 and a molecular weight of 413.43 g/mol. Its IUPAC name is [(2S,3S,6R)-6-[(4-methoxyphenyl)methoxy]-2,4-dimethyl-3,6-dihydro-2H-pyran-3-yl] 4-nitrobenzoate.
| Compound Name | [(2S,3S,6R)-6-[(4-methoxyphenyl)methoxy]-2,4-dimethyl-3,6-dihydro-2H-pyran-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 24741484 |
| Molecular Formula | C22H23NO7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | [(2S,3S,6R)-6-[(4-methoxyphenyl)methoxy]-2,4-dimethyl-3,6-dihydro-2H-pyran-3-yl] 4-nitrobenzoate |
| SMILES | COc1ccc(CO[C@H]2C=C(C)[C@H](OC(=O)c3ccc([N+](=O)[O-])cc3)[C@H](C)O2)cc1 |
| InChI | InChI=1S/C22H23NO7/c1-14-12-20(28-13-16-4-10-19(27-3)11-5-16)29-15(2)21(14)30-22(24)17-6-8-18(9-7-17)23(25)26/h4-12,15,20-21H,13H2,1-3H3/t15-,20+,21-/m0/s1 |
| InChIKey | CLCDZKCUFXIFHX-RVHYNSKXSA-N |
| XLogP | 4.04 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|