C50H49NO11 — CID 11274445
[(1S)-1-[(2R,3S,4S,5R,6S)-5-[(4-methoxyphenyl)methoxy]-3,4,6-tris(phenylmethoxy)oxan-2-yl]-2-phenylmethoxyethyl] 4-nitrobenzoate (PubChem CID 11274445) has the molecular formula C50H49NO11 and a molecular weight of 839.94 g/mol. Its IUPAC name is [(1S)-1-[(2R,3S,4S,5R,6S)-5-[(4-methoxyphenyl)methoxy]-3,4,6-tris(phenylmethoxy)oxan-2-yl]-2-phenylmethoxyethyl] 4-nitrobenzoate.
| Compound Name | [(1S)-1-[(2R,3S,4S,5R,6S)-5-[(4-methoxyphenyl)methoxy]-3,4,6-tris(phenylmethoxy)oxan-2-yl]-2-phenylmethoxyethyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 11274445 |
| Molecular Formula | C50H49NO11 |
| Molecular Weight | 839.94 g/mol |
| Exact Mass | 839.33 |
| IUPAC Name | [(1S)-1-[(2R,3S,4S,5R,6S)-5-[(4-methoxyphenyl)methoxy]-3,4,6-tris(phenylmethoxy)oxan-2-yl]-2-phenylmethoxyethyl] 4-nitrobenzoate |
| SMILES | COc1ccc(CO[C@H]2[C@@H](OCc3ccccc3)O[C@H]([C@H](COCc3ccccc3)OC(=O)c3ccc([N+](=O)[O-])cc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C50H49NO11/c1-55-43-28-22-40(23-29-43)33-59-48-47(58-32-38-18-10-4-11-19-38)46(57-31-37-16-8-3-9-17-37)45(62-50(48)60-34-39-20-12-5-13-21-39)44(35-56-30-36-14-6-2-7-15-36)61-49(52)41-24-26-42(27-25-41)51(53)54/h2-29,44-48,50H,30-35H2,1H3/t44-,45+,46+,47-,48+,50-/m0/s1 |
| InChIKey | AUDXMEBBMXPCNW-VNZHEAAGSA-N |
| XLogP | 9.04 |
| TPSA | 134.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.94 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|