C34H34N2O13 — CID 25112322
[(2R,3R,4R,6R)-6-[(4-methoxyphenyl)methoxy]-2-methyl-3-[[(2S,3S,6S)-2-methyl-3-(4-nitrobenzoyl)oxy-3,6-dihydro-2H-pyran-6-yl]oxy]oxan-4-yl] 4-nitrobenzoate (PubChem CID 25112322) has the molecular formula C34H34N2O13 and a molecular weight of 678.65 g/mol. Its IUPAC name is [(2R,3R,4R,6R)-6-[(4-methoxyphenyl)methoxy]-2-methyl-3-[[(2S,3S,6S)-2-methyl-3-(4-nitrobenzoyl)oxy-3,6-dihydro-2H-pyran-6-yl]oxy]oxan-4-yl] 4-nitrobenzoate.
| Compound Name | [(2R,3R,4R,6R)-6-[(4-methoxyphenyl)methoxy]-2-methyl-3-[[(2S,3S,6S)-2-methyl-3-(4-nitrobenzoyl)oxy-3,6-dihydro-2H-pyran-6-yl]oxy]oxan-4-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 25112322 |
| Molecular Formula | C34H34N2O13 |
| Molecular Weight | 678.65 g/mol |
| Exact Mass | 678.21 |
| IUPAC Name | [(2R,3R,4R,6R)-6-[(4-methoxyphenyl)methoxy]-2-methyl-3-[[(2S,3S,6S)-2-methyl-3-(4-nitrobenzoyl)oxy-3,6-dihydro-2H-pyran-6-yl]oxy]oxan-4-yl] 4-nitrobenzoate |
| SMILES | COc1ccc(CO[C@H]2C[C@@H](OC(=O)c3ccc([N+](=O)[O-])cc3)[C@H](O[C@H]3C=C[C@H](OC(=O)c4ccc([N+](=O)[O-])cc4)[C@H](C)O3)[C@@H](C)O2)cc1 |
| InChI | InChI=1S/C34H34N2O13/c1-20-28(47-33(37)23-6-10-25(11-7-23)35(39)40)16-17-30(45-20)49-32-21(2)46-31(44-19-22-4-14-27(43-3)15-5-22)18-29(32)48-34(38)24-8-12-26(13-9-24)36(41)42/h4-17,20-21,28-32H,18-19H2,1-3H3/t20-,21+,28-,29+,30-,31+,32+/m0/s1 |
| InChIKey | WWUVBGUCSSOLKQ-CQJQJCSDSA-N |
| XLogP | 5.30 |
| TPSA | 185.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.65 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|