C17H19NO8 — CID 132602573
[(2R,3S,6S)-3-acetyloxy-6-[(4-nitrophenyl)methoxy]-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 132602573) has the molecular formula C17H19NO8 and a molecular weight of 365.34 g/mol. Its IUPAC name is [(2R,3S,6S)-3-acetyloxy-6-[(4-nitrophenyl)methoxy]-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6S)-3-acetyloxy-6-[(4-nitrophenyl)methoxy]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 132602573 |
| Molecular Formula | C17H19NO8 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | [(2R,3S,6S)-3-acetyloxy-6-[(4-nitrophenyl)methoxy]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OCc2ccc([N+](=O)[O-])cc2)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H19NO8/c1-11(19)23-10-16-15(25-12(2)20)7-8-17(26-16)24-9-13-3-5-14(6-4-13)18(21)22/h3-8,15-17H,9-10H2,1-2H3/t15-,16+,17-/m0/s1 |
| InChIKey | FPULIYNYETWBTK-BBWFWOEESA-N |
| XLogP | 1.89 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|