C38H44O11 — CID 85372796
[3-acetyloxy-6-[[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 85372796) has the molecular formula C38H44O11 and a molecular weight of 676.76 g/mol. Its IUPAC name is [3-acetyloxy-6-[[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [3-acetyloxy-6-[[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 85372796 |
| Molecular Formula | C38H44O11 |
| Molecular Weight | 676.76 g/mol |
| Exact Mass | 676.29 |
| IUPAC Name | [3-acetyloxy-6-[[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | COC1OC(COC2C=CC(OC(C)=O)C(COC(C)=O)O2)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C38H44O11/c1-26(39)42-24-32-31(47-27(2)40)19-20-34(48-32)43-25-33-35(44-21-28-13-7-4-8-14-28)36(45-22-29-15-9-5-10-16-29)37(38(41-3)49-33)46-23-30-17-11-6-12-18-30/h4-20,31-38H,21-25H2,1-3H3 |
| InChIKey | ZQQPNPXVJFVHGA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 117.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.76 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|