C18H18N2O6 — CID 10713390
5-[(4-methoxyphenyl)methoxy]-3-[(4-nitrophenyl)methyl]-2-oxido-4,5-dihydro-1,2-oxazol-2-ium (PubChem CID 10713390) has the molecular formula C18H18N2O6 and a molecular weight of 358.35 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)methoxy]-3-[(4-nitrophenyl)methyl]-2-oxido-4,5-dihydro-1,2-oxazol-2-ium.
| Compound Name | 5-[(4-methoxyphenyl)methoxy]-3-[(4-nitrophenyl)methyl]-2-oxido-4,5-dihydro-1,2-oxazol-2-ium |
|---|---|
| PubChem CID | 10713390 |
| Molecular Formula | C18H18N2O6 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 5-[(4-methoxyphenyl)methoxy]-3-[(4-nitrophenyl)methyl]-2-oxido-4,5-dihydro-1,2-oxazol-2-ium |
| SMILES | COc1ccc(COC2CC(Cc3ccc([N+](=O)[O-])cc3)=[N+]([O-])O2)cc1 |
| InChI | InChI=1S/C18H18N2O6/c1-24-17-8-4-14(5-9-17)12-25-18-11-16(20(23)26-18)10-13-2-6-15(7-3-13)19(21)22/h2-9,18H,10-12H2,1H3 |
| InChIKey | MUWYHUUFVAUMMA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 96.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|