C15H14BrF3N2O6 — CID 57271170
N-[(2R,3R,4S,6R)-6-bromo-3-hydroxy-2-methyl-3-(4-nitrobenzoyl)oxan-4-yl]-2,2,2-trifluoroacetamide (PubChem CID 57271170) has the molecular formula C15H14BrF3N2O6 and a molecular weight of 455.18 g/mol. Its IUPAC name is N-[(2R,3R,4S,6R)-6-bromo-3-hydroxy-2-methyl-3-(4-nitrobenzoyl)oxan-4-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2R,3R,4S,6R)-6-bromo-3-hydroxy-2-methyl-3-(4-nitrobenzoyl)oxan-4-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 57271170 |
| Molecular Formula | C15H14BrF3N2O6 |
| Molecular Weight | 455.18 g/mol |
| Exact Mass | 454.00 |
| IUPAC Name | N-[(2R,3R,4S,6R)-6-bromo-3-hydroxy-2-methyl-3-(4-nitrobenzoyl)oxan-4-yl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@H]1O[C@H](Br)C[C@H](NC(=O)C(F)(F)F)[C@]1(O)C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H14BrF3N2O6/c1-7-14(24,12(22)8-2-4-9(5-3-8)21(25)26)10(6-11(16)27-7)20-13(23)15(17,18)19/h2-5,7,10-11,24H,6H2,1H3,(H,20,23)/t7-,10+,11+,14+/m1/s1 |
| InChIKey | AIRZBWAHKGSLRW-XVVMBKRBSA-N |
| XLogP | 2.09 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.18 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|