C15H18F3NO10 — CID 97302312
[(2R,3S,4R,5R,6S)-2,3,6-triacetyloxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-4-yl] acetate (PubChem CID 97302312) has the molecular formula C15H18F3NO10 and a molecular weight of 429.30 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-2,3,6-triacetyloxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-4-yl] acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-2,3,6-triacetyloxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 97302312 |
| Molecular Formula | C15H18F3NO10 |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-2,3,6-triacetyloxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1O[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H18F3NO10/c1-5(20)25-10-9(19-14(24)15(16,17)18)12(27-7(3)22)29-13(28-8(4)23)11(10)26-6(2)21/h9-13H,1-4H3,(H,19,24)/t9-,10-,11+,12-,13+/m1/s1 |
| InChIKey | QPRBEZGWUGSTSQ-LBELIVKGSA-N |
| XLogP | -0.29 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|