C12H16F3NO8 — CID 175801145
[(2R,3S,4R,5R,6R)-3-acetyloxy-6-deuterio-4,6-dihydroxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate (PubChem CID 175801145) has the molecular formula C12H16F3NO8 and a molecular weight of 360.26 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3-acetyloxy-6-deuterio-4,6-dihydroxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3-acetyloxy-6-deuterio-4,6-dihydroxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 175801145 |
| Molecular Formula | C12H16F3NO8 |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3-acetyloxy-6-deuterio-4,6-dihydroxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate |
| SMILES | [2H][C@@]1(O)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](O)[C@H]1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H16F3NO8/c1-4(17)22-3-6-9(23-5(2)18)8(19)7(10(20)24-6)16-11(21)12(13,14)15/h6-10,19-20H,3H2,1-2H3,(H,16,21)/t6-,7-,8-,9-,10-/m1/s1/i10D |
| InChIKey | JSICXKAQGKNRAA-CHDAJDDLSA-N |
| XLogP | -1.39 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |