C8H14O4 — CID 142172480
2-[(5R)-4,5-dihydroxy-6-methyloxan-2-yl]acetaldehyde (PubChem CID 142172480) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-[(5R)-4,5-dihydroxy-6-methyloxan-2-yl]acetaldehyde.
| Compound Name | 2-[(5R)-4,5-dihydroxy-6-methyloxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 142172480 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 2-[(5R)-4,5-dihydroxy-6-methyloxan-2-yl]acetaldehyde |
| SMILES | CC1OC(CC=O)CC(O)[C@H]1O |
| InChI | InChI=1S/C8H14O4/c1-5-8(11)7(10)4-6(12-5)2-3-9/h3,5-8,10-11H,2,4H2,1H3/t5?,6?,7?,8-/m0/s1 |
| InChIKey | IKFDUCZXIBURFI-AWEWAEBESA-N |
| XLogP | -0.53 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|