About 2-[(5R)-4,5-dihydroxy-6-methyloxan-2-yl]acetaldehyde
2-[(5R)-4,5-dihydroxy-6-methyloxan-2-yl]acetaldehyde (PubChem CID 142172480) has the molecular formula C8H14O4
and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-[(5R)-4,5-dihydroxy-6-methyloxan-2-yl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[(5R)-4,5-dihydroxy-6-methyloxan-2-yl]acetaldehyde |
| PubChem CID | 142172480 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 2-[(5R)-4,5-dihydroxy-6-methyloxan-2-yl]acetaldehyde |
| SMILES | CC1OC(CC=O)CC(O)[C@H]1O |
| InChI | InChI=1S/C8H14O4/c1-5-8(11)7(10)4-6(12-5)2-3-9/h3,5-8,10-11H,2,4H2,1H3/t5?,6?,7?,8-/m0/s1 |
| InChIKey | IKFDUCZXIBURFI-AWEWAEBESA-N |
| XLogP | -0.53 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5R)-4,5-dihydroxy-6-methyloxan-2-yl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5R)-4,5-dihydroxy-6-methyloxan-2-yl]acetaldehyde?
The IUPAC name of 2-[(5R)-4,5-dihydroxy-6-methyloxan-2-yl]acetaldehyde (CID 142172480) is 2-[(5R)-4,5-dihydroxy-6-methyloxan-2-yl]acetaldehyde.
What is the SMILES notation for 2-[(5R)-4,5-dihydroxy-6-methyloxan-2-yl]acetaldehyde?
The canonical SMILES for 2-[(5R)-4,5-dihydroxy-6-methyloxan-2-yl]acetaldehyde is CC1OC(CC=O)CC(O)[C@H]1O.
What is the InChIKey of 2-[(5R)-4,5-dihydroxy-6-methyloxan-2-yl]acetaldehyde?
The InChIKey is IKFDUCZXIBURFI-AWEWAEBESA-N. The full InChI is InChI=1S/C8H14O4/c1-5-8(11)7(10)4-6(12-5)2-3-9/h3,5-8,10-11H,2,4H2,1H3/t5?,6?,7?,8-/m0/s1.
What are the key properties of 2-[(5R)-4,5-dihydroxy-6-methyloxan-2-yl]acetaldehyde?
2-[(5R)-4,5-dihydroxy-6-methyloxan-2-yl]acetaldehyde has a molecular weight of 174.20 g/mol, XLogP of -0.53, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5R)-4,5-dihydroxy-6-methyloxan-2-yl]acetaldehyde is sourced from PubChem (CID 142172480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).